C10H14ClN3O2 — CID 141469452
2-[2-(1,3-benzodioxol-5-yl)ethyl]guanidine;hydrochloride (PubChem CID 141469452) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethyl]guanidine;hydrochloride.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 141469452 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H13N3O2.ClH/c11-10(12)13-4-3-7-1-2-8-9(5-7)15-6-14-8;/h1-2,5H,3-4,6H2,(H4,11,12,13);1H |
| InChIKey | QUANIWYKBILVLL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|