C11H14N2O2S — CID 141036089
methyl N'-[2-(1,3-benzodioxol-5-yl)ethyl]carbamimidothioate (PubChem CID 141036089) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is methyl N'-[2-(1,3-benzodioxol-5-yl)ethyl]carbamimidothioate.
| Compound Name | methyl N'-[2-(1,3-benzodioxol-5-yl)ethyl]carbamimidothioate |
|---|---|
| PubChem CID | 141036089 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | methyl N'-[2-(1,3-benzodioxol-5-yl)ethyl]carbamimidothioate |
| SMILES | CS/C(N)=N\CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H14N2O2S/c1-16-11(12)13-5-4-8-2-3-9-10(6-8)15-7-14-9/h2-3,6H,4-5,7H2,1H3,(H2,12,13) |
| InChIKey | AZRIOWASJVBUII-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|