C11H15NO3 — CID 171783070
N-[3-(1,3-benzodioxol-5-yl)propyl]-N-methylhydroxylamine (PubChem CID 171783070) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)propyl]-N-methylhydroxylamine.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)propyl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 171783070 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)propyl]-N-methylhydroxylamine |
| SMILES | CN(O)CCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H15NO3/c1-12(13)6-2-3-9-4-5-10-11(7-9)15-8-14-10/h4-5,7,13H,2-3,6,8H2,1H3 |
| InChIKey | MLPPGROWKBHDHN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|