C16H25NO2 — CID 20687152
3-(1,3-benzodioxol-5-yl)-N,N-di(propan-2-yl)propan-1-amine (PubChem CID 20687152) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N,N-di(propan-2-yl)propan-1-amine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N,N-di(propan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 20687152 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N,N-di(propan-2-yl)propan-1-amine |
| SMILES | CC(C)N(CCCc1ccc2c(c1)OCO2)C(C)C |
| InChI | InChI=1S/C16H25NO2/c1-12(2)17(13(3)4)9-5-6-14-7-8-15-16(10-14)19-11-18-15/h7-8,10,12-13H,5-6,9,11H2,1-4H3 |
| InChIKey | JJQYKJCLXABTGO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |