C15H22O2 — CID 142810291
acetylene;5-ethyl-1,3-benzodioxole;2-methylpropane (PubChem CID 142810291) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is acetylene;5-ethyl-1,3-benzodioxole;2-methylpropane.
| Compound Name | acetylene;5-ethyl-1,3-benzodioxole;2-methylpropane |
|---|---|
| PubChem CID | 142810291 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | acetylene;5-ethyl-1,3-benzodioxole;2-methylpropane |
| SMILES | C#C.CC(C)C.CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H10O2.C4H10.C2H2/c1-2-7-3-4-8-9(5-7)11-6-10-8;1-4(2)3;1-2/h3-5H,2,6H2,1H3;4H,1-3H3;1-2H |
| InChIKey | ZOYIEJQSJCTTFE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|