C12H19NO2 — CID 158103316
5-ethyl-1,3-benzodioxole;N-methylethanamine (PubChem CID 158103316) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-ethyl-1,3-benzodioxole;N-methylethanamine.
| Compound Name | 5-ethyl-1,3-benzodioxole;N-methylethanamine |
|---|---|
| PubChem CID | 158103316 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 5-ethyl-1,3-benzodioxole;N-methylethanamine |
| SMILES | CCNC.CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H10O2.C3H9N/c1-2-7-3-4-8-9(5-7)11-6-10-8;1-3-4-2/h3-5H,2,6H2,1H3;4H,3H2,1-2H3 |
| InChIKey | FPNMXENHQBUSHD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |