C12H12O2 — CID 175908044
5-pent-2-ynyl-1,3-benzodioxole (PubChem CID 175908044) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-pent-2-ynyl-1,3-benzodioxole.
| Compound Name | 5-pent-2-ynyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 175908044 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 5-pent-2-ynyl-1,3-benzodioxole |
| SMILES | CCC#CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H12O2/c1-2-3-4-5-10-6-7-11-12(8-10)14-9-13-11/h6-8H,2,5,9H2,1H3 |
| InChIKey | NWFRYBYDRXPYJI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|