C12H16O3 — CID 175326771
ethanol;5-prop-2-enyl-1,3-benzodioxole (PubChem CID 175326771) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is ethanol;5-prop-2-enyl-1,3-benzodioxole.
| Compound Name | ethanol;5-prop-2-enyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 175326771 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | ethanol;5-prop-2-enyl-1,3-benzodioxole |
| SMILES | C=CCc1ccc2c(c1)OCO2.CCO |
| InChI | InChI=1S/C10H10O2.C2H6O/c1-2-3-8-4-5-9-10(6-8)12-7-11-9;1-2-3/h2,4-6H,1,3,7H2;3H,2H2,1H3 |
| InChIKey | VHQNBLVDENBQQE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|