C13H16O3 — CID 122677545
1-(1,3-benzodioxol-5-yl)hex-5-en-3-ol (PubChem CID 122677545) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)hex-5-en-3-ol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)hex-5-en-3-ol |
|---|---|
| PubChem CID | 122677545 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)hex-5-en-3-ol |
| SMILES | C=CCC(O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H16O3/c1-2-3-11(14)6-4-10-5-7-12-13(8-10)16-9-15-12/h2,5,7-8,11,14H,1,3-4,6,9H2 |
| InChIKey | WQZJKVWUPFFMPN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|