C21H24FNO3 — CID 93164394
(2S)-1-[1,3-benzodioxol-5-ylmethyl-[(2-fluorophenyl)methyl]amino]hex-5-en-2-ol (PubChem CID 93164394) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is (2S)-1-[1,3-benzodioxol-5-ylmethyl-[(2-fluorophenyl)methyl]amino]hex-5-en-2-ol.
| Compound Name | (2S)-1-[1,3-benzodioxol-5-ylmethyl-[(2-fluorophenyl)methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93164394 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2S)-1-[1,3-benzodioxol-5-ylmethyl-[(2-fluorophenyl)methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN(Cc1ccc2c(c1)OCO2)Cc1ccccc1F |
| InChI | InChI=1S/C21H24FNO3/c1-2-3-7-18(24)14-23(13-17-6-4-5-8-19(17)22)12-16-9-10-20-21(11-16)26-15-25-20/h2,4-6,8-11,18,24H,1,3,7,12-15H2/t18-/m0/s1 |
| InChIKey | APARHHCPAXKCFK-SFHVURJKSA-N |
| XLogP | 3.88 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|