C21H26FNO — CID 46007568
1-[(4-fluorophenyl)methyl-[(4-methylphenyl)methyl]amino]hex-5-en-2-ol (PubChem CID 46007568) has the molecular formula C21H26FNO and a molecular weight of 327.44 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl-[(4-methylphenyl)methyl]amino]hex-5-en-2-ol.
| Compound Name | 1-[(4-fluorophenyl)methyl-[(4-methylphenyl)methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 46007568 |
| Molecular Formula | C21H26FNO |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl-[(4-methylphenyl)methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN(Cc1ccc(C)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FNO/c1-3-4-5-21(24)16-23(14-18-8-6-17(2)7-9-18)15-19-10-12-20(22)13-11-19/h3,6-13,21,24H,1,4-5,14-16H2,2H3 |
| InChIKey | DYGGEQUFACWLNT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|