C21H27NO — CID 93164977
(2S)-1-[benzyl-[(2-methylphenyl)methyl]amino]hex-5-en-2-ol (PubChem CID 93164977) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (2S)-1-[benzyl-[(2-methylphenyl)methyl]amino]hex-5-en-2-ol.
| Compound Name | (2S)-1-[benzyl-[(2-methylphenyl)methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93164977 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (2S)-1-[benzyl-[(2-methylphenyl)methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN(Cc1ccccc1)Cc1ccccc1C |
| InChI | InChI=1S/C21H27NO/c1-3-4-14-21(23)17-22(15-19-11-6-5-7-12-19)16-20-13-9-8-10-18(20)2/h3,5-13,21,23H,1,4,14-17H2,2H3/t21-/m0/s1 |
| InChIKey | YBPBUDYFHVZGAP-NRFANRHFSA-N |
| XLogP | 4.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|