C29H38N2O — CID 42794802
1-[benzyl-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl]amino]hex-5-en-2-ol (PubChem CID 42794802) has the molecular formula C29H38N2O and a molecular weight of 430.64 g/mol. Its IUPAC name is 1-[benzyl-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl]amino]hex-5-en-2-ol.
| Compound Name | 1-[benzyl-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 42794802 |
| Molecular Formula | C29H38N2O |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | 1-[benzyl-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN(Cc1ccccc1)Cc1cccn1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H38N2O/c1-5-6-14-28(32)23-30(20-24-11-8-7-9-12-24)22-27-13-10-19-31(27)21-25-15-17-26(18-16-25)29(2,3)4/h5,7-13,15-19,28,32H,1,6,14,20-23H2,2-4H3 |
| InChIKey | LMBRBYKWJMEJOK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|