C25H40N2O2 — CID 42794831
1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-(3-methoxypropyl)amino]pentan-2-ol (PubChem CID 42794831) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-(3-methoxypropyl)amino]pentan-2-ol.
| Compound Name | 1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-(3-methoxypropyl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 42794831 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | 1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-(3-methoxypropyl)amino]pentan-2-ol |
| SMILES | CCCC(O)CN(CCCOC)Cc1cccn1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H40N2O2/c1-6-9-24(28)20-26(15-8-17-29-5)19-23-10-7-16-27(23)18-21-11-13-22(14-12-21)25(2,3)4/h7,10-14,16,24,28H,6,8-9,15,17-20H2,1-5H3 |
| InChIKey | KGMKKBDUVUEQTI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|