C25H41N2O2+ — CID 7419748
[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxypentyl]-(3-methoxypropyl)azanium (PubChem CID 7419748) has the molecular formula C25H41N2O2+ and a molecular weight of 401.62 g/mol. Its IUPAC name is [1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxypentyl]-(3-methoxypropyl)azanium.
| Compound Name | [1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxypentyl]-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 7419748 |
| Molecular Formula | C25H41N2O2+ |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.32 |
| IUPAC Name | [1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxypentyl]-(3-methoxypropyl)azanium |
| SMILES | CCC[C@@H](O)C[NH+](CCCOC)Cc1cccn1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H40N2O2/c1-6-9-24(28)20-26(15-8-17-29-5)19-23-10-7-16-27(23)18-21-11-13-22(14-12-21)25(2,3)4/h7,10-14,16,24,28H,6,8-9,15,17-20H2,1-5H3/p+1/t24-/m1/s1 |
| InChIKey | KGMKKBDUVUEQTI-XMMPIXPASA-O |
| XLogP | 3.42 |
| TPSA | 38.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|