C22H32FN2O2+ — CID 7216369
[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2S)-2-hydroxyhex-5-enyl]-(3-methoxypropyl)azanium (PubChem CID 7216369) has the molecular formula C22H32FN2O2+ and a molecular weight of 375.51 g/mol. Its IUPAC name is [1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2S)-2-hydroxyhex-5-enyl]-(3-methoxypropyl)azanium.
| Compound Name | [1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2S)-2-hydroxyhex-5-enyl]-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 7216369 |
| Molecular Formula | C22H32FN2O2+ |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | [1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2S)-2-hydroxyhex-5-enyl]-(3-methoxypropyl)azanium |
| SMILES | C=CCC[C@H](O)C[NH+](CCCOC)Cc1cccn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C22H31FN2O2/c1-3-4-11-22(26)18-24(12-7-14-27-2)17-21-10-6-13-25(21)16-19-8-5-9-20(23)15-19/h3,5-6,8-10,13,15,22,26H,1,4,7,11-12,14,16-18H2,2H3/p+1/t22-/m0/s1 |
| InChIKey | MTWYTWBXOXTOCR-QFIPXVFZSA-O |
| XLogP | 2.42 |
| TPSA | 38.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|