C22H33N2O3+ — CID 7415803
[(2R)-2-hydroxyhex-5-enyl]-(2-methoxyethyl)-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]azanium (PubChem CID 7415803) has the molecular formula C22H33N2O3+ and a molecular weight of 373.52 g/mol. Its IUPAC name is [(2R)-2-hydroxyhex-5-enyl]-(2-methoxyethyl)-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]azanium.
| Compound Name | [(2R)-2-hydroxyhex-5-enyl]-(2-methoxyethyl)-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7415803 |
| Molecular Formula | C22H33N2O3+ |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | [(2R)-2-hydroxyhex-5-enyl]-(2-methoxyethyl)-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]azanium |
| SMILES | C=CCC[C@@H](O)C[NH+](CCOC)Cc1cccn1Cc1cccc(OC)c1 |
| InChI | InChI=1S/C22H32N2O3/c1-4-5-10-21(25)18-23(13-14-26-2)17-20-9-7-12-24(20)16-19-8-6-11-22(15-19)27-3/h4,6-9,11-12,15,21,25H,1,5,10,13-14,16-18H2,2-3H3/p+1/t21-/m1/s1 |
| InChIKey | IKYVWBNKZVJYDY-OAQYLSRUSA-O |
| XLogP | 1.90 |
| TPSA | 48.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|