C23H35N2O3+ — CID 7237069
[(2S)-2-hydroxy-3-prop-2-enoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-(2-methylpropyl)azanium (PubChem CID 7237069) has the molecular formula C23H35N2O3+ and a molecular weight of 387.54 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-prop-2-enoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-(2-methylpropyl)azanium.
| Compound Name | [(2S)-2-hydroxy-3-prop-2-enoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-(2-methylpropyl)azanium |
|---|---|
| PubChem CID | 7237069 |
| Molecular Formula | C23H35N2O3+ |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | [(2S)-2-hydroxy-3-prop-2-enoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-(2-methylpropyl)azanium |
| SMILES | C=CCOC[C@@H](O)C[NH+](Cc1cccn1Cc1cccc(OC)c1)CC(C)C |
| InChI | InChI=1S/C23H34N2O3/c1-5-12-28-18-22(26)17-24(14-19(2)3)16-21-9-7-11-25(21)15-20-8-6-10-23(13-20)27-4/h5-11,13,19,22,26H,1,12,14-18H2,2-4H3/p+1/t22-/m0/s1 |
| InChIKey | XZGGAJHGROXMMA-QFIPXVFZSA-O |
| XLogP | 2.15 |
| TPSA | 48.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|