C23H33N2O2+ — CID 7205873
(1-benzylpyrrol-2-yl)methyl-[(2S)-2-hydroxy-3-prop-2-ynoxypropyl]-(3-methylbutyl)azanium (PubChem CID 7205873) has the molecular formula C23H33N2O2+ and a molecular weight of 369.53 g/mol. Its IUPAC name is (1-benzylpyrrol-2-yl)methyl-[(2S)-2-hydroxy-3-prop-2-ynoxypropyl]-(3-methylbutyl)azanium.
| Compound Name | (1-benzylpyrrol-2-yl)methyl-[(2S)-2-hydroxy-3-prop-2-ynoxypropyl]-(3-methylbutyl)azanium |
|---|---|
| PubChem CID | 7205873 |
| Molecular Formula | C23H33N2O2+ |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | (1-benzylpyrrol-2-yl)methyl-[(2S)-2-hydroxy-3-prop-2-ynoxypropyl]-(3-methylbutyl)azanium |
| SMILES | C#CCOC[C@@H](O)C[NH+](CCC(C)C)Cc1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C23H32N2O2/c1-4-15-27-19-23(26)18-24(14-12-20(2)3)17-22-11-8-13-25(22)16-21-9-6-5-7-10-21/h1,5-11,13,20,23,26H,12,14-19H2,2-3H3/p+1/t23-/m0/s1 |
| InChIKey | XKNXDROYDYNSPY-QHCPKHFHSA-O |
| XLogP | 1.98 |
| TPSA | 38.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|