C22H29N2O3+ — CID 7264471
cyclopropyl-[(2S)-2-hydroxy-3-prop-2-ynoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]azanium (PubChem CID 7264471) has the molecular formula C22H29N2O3+ and a molecular weight of 369.49 g/mol. Its IUPAC name is cyclopropyl-[(2S)-2-hydroxy-3-prop-2-ynoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]azanium.
| Compound Name | cyclopropyl-[(2S)-2-hydroxy-3-prop-2-ynoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7264471 |
| Molecular Formula | C22H29N2O3+ |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | cyclopropyl-[(2S)-2-hydroxy-3-prop-2-ynoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]azanium |
| SMILES | C#CCOC[C@@H](O)C[NH+](Cc1cccn1Cc1cccc(OC)c1)C1CC1 |
| InChI | InChI=1S/C22H28N2O3/c1-3-12-27-17-21(25)16-24(19-9-10-19)15-20-7-5-11-23(20)14-18-6-4-8-22(13-18)26-2/h1,4-8,11,13,19,21,25H,9-10,12,14-17H2,2H3/p+1/t21-/m0/s1 |
| InChIKey | VZJKFNGNWSLXII-NRFANRHFSA-O |
| XLogP | 1.10 |
| TPSA | 48.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|