C23H35N2O4+ — CID 7297185
[(2R)-2-hydroxy-3-prop-2-enoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-(3-methoxypropyl)azanium (PubChem CID 7297185) has the molecular formula C23H35N2O4+ and a molecular weight of 403.54 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-prop-2-enoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-(3-methoxypropyl)azanium.
| Compound Name | [(2R)-2-hydroxy-3-prop-2-enoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 7297185 |
| Molecular Formula | C23H35N2O4+ |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | [(2R)-2-hydroxy-3-prop-2-enoxypropyl]-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl]-(3-methoxypropyl)azanium |
| SMILES | C=CCOC[C@H](O)C[NH+](CCCOC)Cc1cccn1Cc1cccc(OC)c1 |
| InChI | InChI=1S/C23H34N2O4/c1-4-13-29-19-22(26)18-24(11-7-14-27-2)17-21-9-6-12-25(21)16-20-8-5-10-23(15-20)28-3/h4-6,8-10,12,15,22,26H,1,7,11,13-14,16-19H2,2-3H3/p+1/t22-/m1/s1 |
| InChIKey | NYNZIEAEBIAROS-JOCHJYFZSA-O |
| XLogP | 1.53 |
| TPSA | 57.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|