C24H30FN2O2+ — CID 7415019
[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(3-methoxyphenyl)methyl]-(3-methoxypropyl)azanium (PubChem CID 7415019) has the molecular formula C24H30FN2O2+ and a molecular weight of 397.51 g/mol. Its IUPAC name is [1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(3-methoxyphenyl)methyl]-(3-methoxypropyl)azanium.
| Compound Name | [1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(3-methoxyphenyl)methyl]-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 7415019 |
| Molecular Formula | C24H30FN2O2+ |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | [1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(3-methoxyphenyl)methyl]-(3-methoxypropyl)azanium |
| SMILES | COCCC[NH+](Cc1cccc(OC)c1)Cc1cccn1Cc1ccccc1F |
| InChI | InChI=1S/C24H29FN2O2/c1-28-15-7-13-26(17-20-8-5-11-23(16-20)29-2)19-22-10-6-14-27(22)18-21-9-3-4-12-24(21)25/h3-6,8-12,14,16H,7,13,15,17-19H2,1-2H3/p+1 |
| InChIKey | OOHQPTHWHQQDLF-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 27.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|