C20H29N2O+ — CID 7365246
3-methoxypropyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-prop-2-enylazanium (PubChem CID 7365246) has the molecular formula C20H29N2O+ and a molecular weight of 313.47 g/mol. Its IUPAC name is 3-methoxypropyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-prop-2-enylazanium.
| Compound Name | 3-methoxypropyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 7365246 |
| Molecular Formula | C20H29N2O+ |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 3-methoxypropyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](CCCOC)Cc1cccn1Cc1ccccc1C |
| InChI | InChI=1S/C20H28N2O/c1-4-12-21(13-8-15-23-3)17-20-11-7-14-22(20)16-19-10-6-5-9-18(19)2/h4-7,9-11,14H,1,8,12-13,15-17H2,2-3H3/p+1 |
| InChIKey | BUCARALZBXYHRG-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 18.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|