C22H32FN2O3+ — CID 7400455
[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]-(3-methoxypropyl)azanium (PubChem CID 7400455) has the molecular formula C22H32FN2O3+ and a molecular weight of 391.51 g/mol. Its IUPAC name is [1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]-(3-methoxypropyl)azanium.
| Compound Name | [1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]-(3-methoxypropyl)azanium |
|---|---|
| PubChem CID | 7400455 |
| Molecular Formula | C22H32FN2O3+ |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | [1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]-(3-methoxypropyl)azanium |
| SMILES | C=CCOC[C@@H](O)C[NH+](CCCOC)Cc1cccn1Cc1ccccc1F |
| InChI | InChI=1S/C22H31FN2O3/c1-3-13-28-18-21(26)17-24(11-7-14-27-2)16-20-9-6-12-25(20)15-19-8-4-5-10-22(19)23/h3-6,8-10,12,21,26H,1,7,11,13-18H2,2H3/p+1/t21-/m0/s1 |
| InChIKey | YLLZFSDEVHTWPR-NRFANRHFSA-O |
| XLogP | 1.66 |
| TPSA | 48.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|