C20H28FN2O+ — CID 7202074
[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxy-3-methylbutyl]-prop-2-enylazanium (PubChem CID 7202074) has the molecular formula C20H28FN2O+ and a molecular weight of 331.46 g/mol. Its IUPAC name is [1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxy-3-methylbutyl]-prop-2-enylazanium.
| Compound Name | [1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxy-3-methylbutyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 7202074 |
| Molecular Formula | C20H28FN2O+ |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | [1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxy-3-methylbutyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](Cc1cccn1Cc1ccccc1F)C[C@H](O)C(C)C |
| InChI | InChI=1S/C20H27FN2O/c1-4-11-22(15-20(24)16(2)3)14-18-9-7-12-23(18)13-17-8-5-6-10-19(17)21/h4-10,12,16,20,24H,1,11,13-15H2,2-3H3/p+1/t20-/m0/s1 |
| InChIKey | ISLKDYHYLDPELC-FQEVSTJZSA-O |
| XLogP | 2.26 |
| TPSA | 29.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|