C17H26FNO3 — CID 24713876
1-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 24713876) has the molecular formula C17H26FNO3 and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 24713876 |
| Molecular Formula | C17H26FNO3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)CN(CCCOC)Cc1ccccc1F |
| InChI | InChI=1S/C17H26FNO3/c1-3-10-22-14-16(20)13-19(9-6-11-21-2)12-15-7-4-5-8-17(15)18/h3-5,7-8,16,20H,1,6,9-14H2,2H3 |
| InChIKey | LTDHRBZEYPSMRE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|