C16H26FNO3 — CID 93161184
(2R)-1-[(2-fluorophenyl)methyl-(2-methoxyethyl)amino]-3-propan-2-yloxypropan-2-ol (PubChem CID 93161184) has the molecular formula C16H26FNO3 and a molecular weight of 299.39 g/mol. Its IUPAC name is (2R)-1-[(2-fluorophenyl)methyl-(2-methoxyethyl)amino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | (2R)-1-[(2-fluorophenyl)methyl-(2-methoxyethyl)amino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 93161184 |
| Molecular Formula | C16H26FNO3 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (2R)-1-[(2-fluorophenyl)methyl-(2-methoxyethyl)amino]-3-propan-2-yloxypropan-2-ol |
| SMILES | COCCN(Cc1ccccc1F)C[C@@H](O)COC(C)C |
| InChI | InChI=1S/C16H26FNO3/c1-13(2)21-12-15(19)11-18(8-9-20-3)10-14-6-4-5-7-16(14)17/h4-7,13,15,19H,8-12H2,1-3H3/t15-/m1/s1 |
| InChIKey | KTVIXCOJQDQMNK-OAHLLOKOSA-N |
| XLogP | 2.06 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |