C19H33NO5 — CID 93161589
(2R)-1-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]-3-propan-2-yloxypropan-2-ol (PubChem CID 93161589) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is (2R)-1-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | (2R)-1-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 93161589 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (2R)-1-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]-3-propan-2-yloxypropan-2-ol |
| SMILES | COCCCN(Cc1cccc(OC)c1OC)C[C@@H](O)COC(C)C |
| InChI | InChI=1S/C19H33NO5/c1-15(2)25-14-17(21)13-20(10-7-11-22-3)12-16-8-6-9-18(23-4)19(16)24-5/h6,8-9,15,17,21H,7,10-14H2,1-5H3/t17-/m1/s1 |
| InChIKey | XTHDQQPHZDRANR-QGZVFWFLSA-N |
| XLogP | 2.33 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|