C20H35NO5 — CID 46007047
1-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]-3-(2-methylpropoxy)propan-2-ol (PubChem CID 46007047) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is 1-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]-3-(2-methylpropoxy)propan-2-ol.
| Compound Name | 1-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]-3-(2-methylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 46007047 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 1-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]-3-(2-methylpropoxy)propan-2-ol |
| SMILES | COCCCN(Cc1cccc(OC)c1OC)CC(O)COCC(C)C |
| InChI | InChI=1S/C20H35NO5/c1-16(2)14-26-15-18(22)13-21(10-7-11-23-3)12-17-8-6-9-19(24-4)20(17)25-5/h6,8-9,16,18,22H,7,10-15H2,1-5H3 |
| InChIKey | SAIUFNJXEFZJFY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|