C22H30ClNO5 — CID 46007052
1-(4-chlorophenoxy)-3-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]propan-2-ol (PubChem CID 46007052) has the molecular formula C22H30ClNO5 and a molecular weight of 423.94 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]propan-2-ol.
| Compound Name | 1-(4-chlorophenoxy)-3-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 46007052 |
| Molecular Formula | C22H30ClNO5 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-[(2,3-dimethoxyphenyl)methyl-(3-methoxypropyl)amino]propan-2-ol |
| SMILES | COCCCN(Cc1cccc(OC)c1OC)CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H30ClNO5/c1-26-13-5-12-24(14-17-6-4-7-21(27-2)22(17)28-3)15-19(25)16-29-20-10-8-18(23)9-11-20/h4,6-11,19,25H,5,12-16H2,1-3H3 |
| InChIKey | HZSIGRCNSKUDIZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|