C20H26ClNO4 — CID 93162860
(2S)-1-(4-chlorophenoxy)-3-[2-methoxyethyl-[(3-methoxyphenyl)methyl]amino]propan-2-ol (PubChem CID 93162860) has the molecular formula C20H26ClNO4 and a molecular weight of 379.88 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenoxy)-3-[2-methoxyethyl-[(3-methoxyphenyl)methyl]amino]propan-2-ol.
| Compound Name | (2S)-1-(4-chlorophenoxy)-3-[2-methoxyethyl-[(3-methoxyphenyl)methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 93162860 |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (2S)-1-(4-chlorophenoxy)-3-[2-methoxyethyl-[(3-methoxyphenyl)methyl]amino]propan-2-ol |
| SMILES | COCCN(Cc1cccc(OC)c1)C[C@H](O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClNO4/c1-24-11-10-22(13-16-4-3-5-20(12-16)25-2)14-18(23)15-26-19-8-6-17(21)7-9-19/h3-9,12,18,23H,10-11,13-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | QFTCHWCYRJHIEZ-SFHVURJKSA-N |
| XLogP | 3.24 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |