C19H27NO5 — CID 24713597
1-(furan-2-ylmethoxy)-3-[2-methoxyethyl-[(3-methoxyphenyl)methyl]amino]propan-2-ol (PubChem CID 24713597) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-(furan-2-ylmethoxy)-3-[2-methoxyethyl-[(3-methoxyphenyl)methyl]amino]propan-2-ol.
| Compound Name | 1-(furan-2-ylmethoxy)-3-[2-methoxyethyl-[(3-methoxyphenyl)methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 24713597 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 1-(furan-2-ylmethoxy)-3-[2-methoxyethyl-[(3-methoxyphenyl)methyl]amino]propan-2-ol |
| SMILES | COCCN(Cc1cccc(OC)c1)CC(O)COCc1ccco1 |
| InChI | InChI=1S/C19H27NO5/c1-22-10-8-20(12-16-5-3-6-18(11-16)23-2)13-17(21)14-24-15-19-7-4-9-25-19/h3-7,9,11,17,21H,8,10,12-15H2,1-2H3 |
| InChIKey | DMMKNEHCLZIVJP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |