C20H29NO4 — CID 99730490
(2R)-1-[[(2S)-butan-2-yl]-[(3-methoxyphenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 99730490) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2R)-1-[[(2S)-butan-2-yl]-[(3-methoxyphenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | (2R)-1-[[(2S)-butan-2-yl]-[(3-methoxyphenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 99730490 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | (2R)-1-[[(2S)-butan-2-yl]-[(3-methoxyphenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | CC[C@H](C)N(Cc1cccc(OC)c1)C[C@@H](O)COCc1ccco1 |
| InChI | InChI=1S/C20H29NO4/c1-4-16(2)21(12-17-7-5-8-19(11-17)23-3)13-18(22)14-24-15-20-9-6-10-25-20/h5-11,16,18,22H,4,12-15H2,1-3H3/t16-,18+/m0/s1 |
| InChIKey | RJZNVZBPZMKSDK-FUHWJXTLSA-N |
| XLogP | 3.47 |
| TPSA | 55.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |