C22H31NO3 — CID 99732497
(2R)-1-[[(2R)-butan-2-yl]-[(4-methoxyphenyl)methyl]amino]-3-phenylmethoxypropan-2-ol (PubChem CID 99732497) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (2R)-1-[[(2R)-butan-2-yl]-[(4-methoxyphenyl)methyl]amino]-3-phenylmethoxypropan-2-ol.
| Compound Name | (2R)-1-[[(2R)-butan-2-yl]-[(4-methoxyphenyl)methyl]amino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 99732497 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (2R)-1-[[(2R)-butan-2-yl]-[(4-methoxyphenyl)methyl]amino]-3-phenylmethoxypropan-2-ol |
| SMILES | CC[C@@H](C)N(Cc1ccc(OC)cc1)C[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C22H31NO3/c1-4-18(2)23(14-19-10-12-22(25-3)13-11-19)15-21(24)17-26-16-20-8-6-5-7-9-20/h5-13,18,21,24H,4,14-17H2,1-3H3/t18-,21-/m1/s1 |
| InChIKey | KUKMVOKGXBWVIL-WIYYLYMNSA-N |
| XLogP | 3.87 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |