C21H29NO3 — CID 93160595
(2R)-1-[(4-methoxyphenyl)methyl-propylamino]-3-phenylmethoxypropan-2-ol (PubChem CID 93160595) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (2R)-1-[(4-methoxyphenyl)methyl-propylamino]-3-phenylmethoxypropan-2-ol.
| Compound Name | (2R)-1-[(4-methoxyphenyl)methyl-propylamino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 93160595 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (2R)-1-[(4-methoxyphenyl)methyl-propylamino]-3-phenylmethoxypropan-2-ol |
| SMILES | CCCN(Cc1ccc(OC)cc1)C[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C21H29NO3/c1-3-13-22(14-18-9-11-21(24-2)12-10-18)15-20(23)17-25-16-19-7-5-4-6-8-19/h4-12,20,23H,3,13-17H2,1-2H3/t20-/m1/s1 |
| InChIKey | XEDMRJAFDWKSDY-HXUWFJFHSA-N |
| XLogP | 3.48 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |