C16H27NO4 — CID 95232031
(2S)-1-[2-hydroxyethyl(propyl)amino]-3-[(4-methoxyphenyl)methoxy]propan-2-ol (PubChem CID 95232031) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is (2S)-1-[2-hydroxyethyl(propyl)amino]-3-[(4-methoxyphenyl)methoxy]propan-2-ol.
| Compound Name | (2S)-1-[2-hydroxyethyl(propyl)amino]-3-[(4-methoxyphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 95232031 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (2S)-1-[2-hydroxyethyl(propyl)amino]-3-[(4-methoxyphenyl)methoxy]propan-2-ol |
| SMILES | CCCN(CCO)C[C@H](O)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C16H27NO4/c1-3-8-17(9-10-18)11-15(19)13-21-12-14-4-6-16(20-2)7-5-14/h4-7,15,18-19H,3,8-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | AXZCMADUJNITMV-HNNXBMFYSA-N |
| XLogP | 1.28 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |