C20H26O5 — CID 14814213
1,4-bis[(4-methoxyphenyl)methoxy]butan-2-ol (PubChem CID 14814213) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is 1,4-bis[(4-methoxyphenyl)methoxy]butan-2-ol.
| Compound Name | 1,4-bis[(4-methoxyphenyl)methoxy]butan-2-ol |
|---|---|
| PubChem CID | 14814213 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1,4-bis[(4-methoxyphenyl)methoxy]butan-2-ol |
| SMILES | COc1ccc(COCCC(O)COCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H26O5/c1-22-19-7-3-16(4-8-19)13-24-12-11-18(21)15-25-14-17-5-9-20(23-2)10-6-17/h3-10,18,21H,11-15H2,1-2H3 |
| InChIKey | NOPZWOQQLSMHQO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|