C12H18O4 — CID 44629947
(2R)-4-[(4-methoxyphenyl)methoxy]butane-1,2-diol (PubChem CID 44629947) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (2R)-4-[(4-methoxyphenyl)methoxy]butane-1,2-diol.
| Compound Name | (2R)-4-[(4-methoxyphenyl)methoxy]butane-1,2-diol |
|---|---|
| PubChem CID | 44629947 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (2R)-4-[(4-methoxyphenyl)methoxy]butane-1,2-diol |
| SMILES | COc1ccc(COCC[C@@H](O)CO)cc1 |
| InChI | InChI=1S/C12H18O4/c1-15-12-4-2-10(3-5-12)9-16-7-6-11(14)8-13/h2-5,11,13-14H,6-9H2,1H3/t11-/m1/s1 |
| InChIKey | YRHIJTKHDXQBLC-LLVKDONJSA-N |
| XLogP | 0.96 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|