C12H18O4 — CID 44629983
4-[(4-methoxyphenyl)methoxy]butane-1,3-diol (PubChem CID 44629983) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methoxy]butane-1,3-diol.
| Compound Name | 4-[(4-methoxyphenyl)methoxy]butane-1,3-diol |
|---|---|
| PubChem CID | 44629983 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 4-[(4-methoxyphenyl)methoxy]butane-1,3-diol |
| SMILES | COc1ccc(COCC(O)CCO)cc1 |
| InChI | InChI=1S/C12H18O4/c1-15-12-4-2-10(3-5-12)8-16-9-11(14)6-7-13/h2-5,11,13-14H,6-9H2,1H3 |
| InChIKey | GCVOAHFIFQYCKH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |