C22H30O6 — CID 10894444
(3S,4S)-1,6-bis[(4-methoxyphenyl)methoxy]hexane-3,4-diol (PubChem CID 10894444) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is (3S,4S)-1,6-bis[(4-methoxyphenyl)methoxy]hexane-3,4-diol.
| Compound Name | (3S,4S)-1,6-bis[(4-methoxyphenyl)methoxy]hexane-3,4-diol |
|---|---|
| PubChem CID | 10894444 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (3S,4S)-1,6-bis[(4-methoxyphenyl)methoxy]hexane-3,4-diol |
| SMILES | COc1ccc(COCC[C@H](O)[C@@H](O)CCOCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H30O6/c1-25-19-7-3-17(4-8-19)15-27-13-11-21(23)22(24)12-14-28-16-18-5-9-20(26-2)10-6-18/h3-10,21-24H,11-16H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | PFZDCWTVAAXWMG-VXKWHMMOSA-N |
| XLogP | 2.94 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|