C14H18O3 — CID 11770384
(3S)-1-[(4-methoxyphenyl)methoxy]hexa-4,5-dien-3-ol (PubChem CID 11770384) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (3S)-1-[(4-methoxyphenyl)methoxy]hexa-4,5-dien-3-ol.
| Compound Name | (3S)-1-[(4-methoxyphenyl)methoxy]hexa-4,5-dien-3-ol |
|---|---|
| PubChem CID | 11770384 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (3S)-1-[(4-methoxyphenyl)methoxy]hexa-4,5-dien-3-ol |
| SMILES | C=C=C[C@@H](O)CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H18O3/c1-3-4-13(15)9-10-17-11-12-5-7-14(16-2)8-6-12/h4-8,13,15H,1,9-11H2,2H3/t13-/m1/s1 |
| InChIKey | XSTQFQLFZCZGSR-CYBMUJFWSA-N |
| XLogP | 2.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|