C19H24O3 — CID 20758158
(3S)-1-[(4-methoxyphenyl)methoxy]-5-phenylpentan-3-ol (PubChem CID 20758158) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3S)-1-[(4-methoxyphenyl)methoxy]-5-phenylpentan-3-ol.
| Compound Name | (3S)-1-[(4-methoxyphenyl)methoxy]-5-phenylpentan-3-ol |
|---|---|
| PubChem CID | 20758158 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (3S)-1-[(4-methoxyphenyl)methoxy]-5-phenylpentan-3-ol |
| SMILES | COc1ccc(COCC[C@@H](O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24O3/c1-21-19-11-8-17(9-12-19)15-22-14-13-18(20)10-7-16-5-3-2-4-6-16/h2-6,8-9,11-12,18,20H,7,10,13-15H2,1H3/t18-/m0/s1 |
| InChIKey | CTEWNSAFZZKQLZ-SFHVURJKSA-N |
| XLogP | 3.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|