About (2S)-1,4-bis(phenylmethoxy)butan-2-ol
(2S)-1,4-bis(phenylmethoxy)butan-2-ol (PubChem CID 14814227) has the molecular formula C18H22O3
and a molecular weight of 286.37 g/mol. Its IUPAC name is (2S)-1,4-bis(phenylmethoxy)butan-2-ol.
Molecular Properties
| Compound Name | (2S)-1,4-bis(phenylmethoxy)butan-2-ol |
| PubChem CID | 14814227 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (2S)-1,4-bis(phenylmethoxy)butan-2-ol |
| SMILES | O[C@@H](CCOCc1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C18H22O3/c19-18(15-21-14-17-9-5-2-6-10-17)11-12-20-13-16-7-3-1-4-8-16/h1-10,18-19H,11-15H2/t18-/m0/s1 |
| InChIKey | OQRYLHKBIBPOHV-SFHVURJKSA-N |
| XLogP | 3.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,4-bis(phenylmethoxy)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,4-bis(phenylmethoxy)butan-2-ol?
The IUPAC name of (2S)-1,4-bis(phenylmethoxy)butan-2-ol (CID 14814227) is (2S)-1,4-bis(phenylmethoxy)butan-2-ol.
What is the SMILES notation for (2S)-1,4-bis(phenylmethoxy)butan-2-ol?
The canonical SMILES for (2S)-1,4-bis(phenylmethoxy)butan-2-ol is O[C@@H](CCOCc1ccccc1)COCc1ccccc1.
What is the InChIKey of (2S)-1,4-bis(phenylmethoxy)butan-2-ol?
The InChIKey is OQRYLHKBIBPOHV-SFHVURJKSA-N. The full InChI is InChI=1S/C18H22O3/c19-18(15-21-14-17-9-5-2-6-10-17)11-12-20-13-16-7-3-1-4-8-16/h1-10,18-19H,11-15H2/t18-/m0/s1.
What are the key properties of (2S)-1,4-bis(phenylmethoxy)butan-2-ol?
(2S)-1,4-bis(phenylmethoxy)butan-2-ol has a molecular weight of 286.37 g/mol, XLogP of 3.17, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,4-bis(phenylmethoxy)butan-2-ol is sourced from PubChem (CID 14814227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).