About azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine
azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine (PubChem CID 69422231) has the molecular formula C17H24N2O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine.
Molecular Properties
| Compound Name | azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine |
| PubChem CID | 69422231 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine |
| SMILES | COc1ccc([C@H](N)CCOCc2ccccc2)cc1.N |
| InChI | InChI=1S/C17H21NO2.H3N/c1-19-16-9-7-15(8-10-16)17(18)11-12-20-13-14-5-3-2-4-6-14;/h2-10,17H,11-13,18H2,1H3;1H3/t17-;/m1./s1 |
| InChIKey | FSTPPSAUUIWZBR-UNTBIKODSA-N |
| XLogP | 3.46 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine?
The IUPAC name of azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine (CID 69422231) is azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine.
What is the SMILES notation for azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine?
The canonical SMILES for azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine is COc1ccc([C@H](N)CCOCc2ccccc2)cc1.N.
What is the InChIKey of azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine?
The InChIKey is FSTPPSAUUIWZBR-UNTBIKODSA-N. The full InChI is InChI=1S/C17H21NO2.H3N/c1-19-16-9-7-15(8-10-16)17(18)11-12-20-13-14-5-3-2-4-6-14;/h2-10,17H,11-13,18H2,1H3;1H3/t17-;/m1./s1.
What are the key properties of azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine?
azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine has a molecular weight of 288.39 g/mol, XLogP of 3.46, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(1R)-1-(4-methoxyphenyl)-3-phenylmethoxypropan-1-amine is sourced from PubChem (CID 69422231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).