C21H28O6 — CID 54598131
(1R,2S,3R)-1-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-1-phenylpentane-2,3-diol (PubChem CID 54598131) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (1R,2S,3R)-1-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-1-phenylpentane-2,3-diol.
| Compound Name | (1R,2S,3R)-1-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-1-phenylpentane-2,3-diol |
|---|---|
| PubChem CID | 54598131 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (1R,2S,3R)-1-(methoxymethoxy)-5-[(4-methoxyphenyl)methoxy]-1-phenylpentane-2,3-diol |
| SMILES | COCO[C@H](c1ccccc1)[C@@H](O)[C@H](O)CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H28O6/c1-24-15-27-21(17-6-4-3-5-7-17)20(23)19(22)12-13-26-14-16-8-10-18(25-2)11-9-16/h3-11,19-23H,12-15H2,1-2H3/t19-,20+,21-/m1/s1 |
| InChIKey | UHUUFZSCBBOMJM-QHAWAJNXSA-N |
| XLogP | 2.69 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|