C25H33NO4 — CID 11464055
(3S,4S)-1-[(4-methoxyphenyl)methoxy]-4-[[(2S)-1-phenylmethoxybut-3-en-2-yl]amino]hex-5-en-3-ol (PubChem CID 11464055) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is (3S,4S)-1-[(4-methoxyphenyl)methoxy]-4-[[(2S)-1-phenylmethoxybut-3-en-2-yl]amino]hex-5-en-3-ol.
| Compound Name | (3S,4S)-1-[(4-methoxyphenyl)methoxy]-4-[[(2S)-1-phenylmethoxybut-3-en-2-yl]amino]hex-5-en-3-ol |
|---|---|
| PubChem CID | 11464055 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | (3S,4S)-1-[(4-methoxyphenyl)methoxy]-4-[[(2S)-1-phenylmethoxybut-3-en-2-yl]amino]hex-5-en-3-ol |
| SMILES | C=C[C@H](N[C@@H](C=C)COCc1ccccc1)[C@@H](O)CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H33NO4/c1-4-22(19-30-18-20-9-7-6-8-10-20)26-24(5-2)25(27)15-16-29-17-21-11-13-23(28-3)14-12-21/h4-14,22,24-27H,1-2,15-19H2,3H3/t22-,24-,25-/m0/s1 |
| InChIKey | BKMXWSJQMLUCKW-HVCNVCAESA-N |
| XLogP | 3.88 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|