C27H38O4 — CID 101054913
(3R,4R,5S,6R)-6-[(4-methoxyphenyl)methoxy]-3,5-dimethyl-10-phenylmethoxydec-1-en-4-ol (PubChem CID 101054913) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is (3R,4R,5S,6R)-6-[(4-methoxyphenyl)methoxy]-3,5-dimethyl-10-phenylmethoxydec-1-en-4-ol.
| Compound Name | (3R,4R,5S,6R)-6-[(4-methoxyphenyl)methoxy]-3,5-dimethyl-10-phenylmethoxydec-1-en-4-ol |
|---|---|
| PubChem CID | 101054913 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | (3R,4R,5S,6R)-6-[(4-methoxyphenyl)methoxy]-3,5-dimethyl-10-phenylmethoxydec-1-en-4-ol |
| SMILES | C=C[C@@H](C)[C@@H](O)[C@H](C)[C@@H](CCCCOCc1ccccc1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H38O4/c1-5-21(2)27(28)22(3)26(31-20-24-14-16-25(29-4)17-15-24)13-9-10-18-30-19-23-11-7-6-8-12-23/h5-8,11-12,14-17,21-22,26-28H,1,9-10,13,18-20H2,2-4H3/t21-,22-,26-,27-/m1/s1 |
| InChIKey | JWOJNPNENRFQTE-IKAXQFJBSA-N |
| XLogP | 5.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|