C29H34O6 — CID 72976602
2-[(4-methoxyphenyl)methoxy]-3,5-bis(phenylmethoxy)hept-6-ene-1,4-diol (PubChem CID 72976602) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methoxy]-3,5-bis(phenylmethoxy)hept-6-ene-1,4-diol.
| Compound Name | 2-[(4-methoxyphenyl)methoxy]-3,5-bis(phenylmethoxy)hept-6-ene-1,4-diol |
|---|---|
| PubChem CID | 72976602 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 2-[(4-methoxyphenyl)methoxy]-3,5-bis(phenylmethoxy)hept-6-ene-1,4-diol |
| SMILES | C=CC(OCc1ccccc1)C(O)C(OCc1ccccc1)C(CO)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H34O6/c1-3-26(33-19-22-10-6-4-7-11-22)28(31)29(35-21-23-12-8-5-9-13-23)27(18-30)34-20-24-14-16-25(32-2)17-15-24/h3-17,26-31H,1,18-21H2,2H3 |
| InChIKey | XZZWCGSFCJGKSO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|