C13H18O3 — CID 46855133
(2S,3R,4R)-4-phenylmethoxyhex-5-ene-2,3-diol (PubChem CID 46855133) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (2S,3R,4R)-4-phenylmethoxyhex-5-ene-2,3-diol.
| Compound Name | (2S,3R,4R)-4-phenylmethoxyhex-5-ene-2,3-diol |
|---|---|
| PubChem CID | 46855133 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2S,3R,4R)-4-phenylmethoxyhex-5-ene-2,3-diol |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H](O)[C@H](C)O |
| InChI | InChI=1S/C13H18O3/c1-3-12(13(15)10(2)14)16-9-11-7-5-4-6-8-11/h3-8,10,12-15H,1,9H2,2H3/t10-,12+,13+/m0/s1 |
| InChIKey | NZWPQGBNNSAVNG-CYZMBNFOSA-N |
| XLogP | 1.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|