C16H24O — CID 145114900
[(2S,4R)-4-ethenylheptan-2-yl]oxymethylbenzene (PubChem CID 145114900) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is [(2S,4R)-4-ethenylheptan-2-yl]oxymethylbenzene.
| Compound Name | [(2S,4R)-4-ethenylheptan-2-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 145114900 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | [(2S,4R)-4-ethenylheptan-2-yl]oxymethylbenzene |
| SMILES | C=CC(CCC)C[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C16H24O/c1-4-9-15(5-2)12-14(3)17-13-16-10-7-6-8-11-16/h5-8,10-11,14-15H,2,4,9,12-13H2,1,3H3/t14-,15?/m0/s1 |
| InChIKey | VDCBCNJOJQJDHB-MLCCFXAWSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|